C29H37ClN2O6 — CID 23950809
prop-2-enyl (5R,6R,7R)-2-[(4-chlorophenyl)-prop-2-enylcarbamoyl]-3-[(2R,3S)-1-hydroxy-3-methylpentan-2-yl]-7-methyl-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate (PubChem CID 23950809) has the molecular formula C29H37ClN2O6 and a molecular weight of 545.08 g/mol. Its IUPAC name is prop-2-enyl (5R,6R,7R)-2-[(4-chlorophenyl)-prop-2-enylcarbamoyl]-3-[(2R,3S)-1-hydroxy-3-methylpentan-2-yl]-7-methyl-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate.
| Compound Name | prop-2-enyl (5R,6R,7R)-2-[(4-chlorophenyl)-prop-2-enylcarbamoyl]-3-[(2R,3S)-1-hydroxy-3-methylpentan-2-yl]-7-methyl-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate |
|---|---|
| PubChem CID | 23950809 |
| Molecular Formula | C29H37ClN2O6 |
| Molecular Weight | 545.08 g/mol |
| Exact Mass | 544.23 |
| IUPAC Name | prop-2-enyl (5R,6R,7R)-2-[(4-chlorophenyl)-prop-2-enylcarbamoyl]-3-[(2R,3S)-1-hydroxy-3-methylpentan-2-yl]-7-methyl-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate |
| SMILES | C=CCOC(=O)[C@@H]1[C@H]2C(=O)N([C@@H](CO)[C@@H](C)CC)C(C(=O)N(CC=C)c3ccc(Cl)cc3)C23CC[C@@]1(C)O3 |
| InChI | InChI=1S/C29H37ClN2O6/c1-6-15-31(20-11-9-19(30)10-12-20)26(35)24-29-14-13-28(5,38-29)23(27(36)37-16-7-2)22(29)25(34)32(24)21(17-33)18(4)8-3/h6-7,9-12,18,21-24,33H,1-2,8,13-17H2,3-5H3/t18-,21-,22-,23-,24?,28+,29?/m0/s1 |
| InChIKey | UHYITHDMAALJQY-NLVFTZEFSA-N |
| XLogP | 3.76 |
| TPSA | 96.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.08 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|