C36H44N2O6 — CID 23951052
hex-5-enyl (5R,6S,7S)-2-[(2,5-dimethylphenyl)-prop-2-enylcarbamoyl]-3-[(2R)-1-hydroxy-3-phenylpropan-2-yl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate (PubChem CID 23951052) has the molecular formula C36H44N2O6 and a molecular weight of 600.76 g/mol. Its IUPAC name is hex-5-enyl (5R,6S,7S)-2-[(2,5-dimethylphenyl)-prop-2-enylcarbamoyl]-3-[(2R)-1-hydroxy-3-phenylpropan-2-yl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate.
| Compound Name | hex-5-enyl (5R,6S,7S)-2-[(2,5-dimethylphenyl)-prop-2-enylcarbamoyl]-3-[(2R)-1-hydroxy-3-phenylpropan-2-yl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate |
|---|---|
| PubChem CID | 23951052 |
| Molecular Formula | C36H44N2O6 |
| Molecular Weight | 600.76 g/mol |
| Exact Mass | 600.32 |
| IUPAC Name | hex-5-enyl (5R,6S,7S)-2-[(2,5-dimethylphenyl)-prop-2-enylcarbamoyl]-3-[(2R)-1-hydroxy-3-phenylpropan-2-yl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate |
| SMILES | C=CCCCCOC(=O)[C@@H]1[C@@H]2CCC3(O2)C(C(=O)N(CC=C)c2cc(C)ccc2C)N([C@@H](CO)Cc2ccccc2)C(=O)[C@H]13 |
| InChI | InChI=1S/C36H44N2O6/c1-5-7-8-12-20-43-35(42)30-29-17-18-36(44-29)31(30)33(40)38(27(23-39)22-26-13-10-9-11-14-26)32(36)34(41)37(19-6-2)28-21-24(3)15-16-25(28)4/h5-6,9-11,13-16,21,27,29-32,39H,1-2,7-8,12,17-20,22-23H2,3-4H3/t27-,29+,30-,31+,32?,36?/m1/s1 |
| InChIKey | PILJPFCJAHZNJN-XVANTHHISA-N |
| XLogP | 4.70 |
| TPSA | 96.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.76 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|