C33H47N3O5S — CID 23952912
(5S,6R,7S)-6-N-(4-ethoxyphenyl)-3-(5-hydroxypentyl)-7-methyl-4-oxo-2-N-propan-2-yl-2-N,6-N-bis(prop-2-enyl)-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23952912) has the molecular formula C33H47N3O5S and a molecular weight of 597.82 g/mol. Its IUPAC name is (5S,6R,7S)-6-N-(4-ethoxyphenyl)-3-(5-hydroxypentyl)-7-methyl-4-oxo-2-N-propan-2-yl-2-N,6-N-bis(prop-2-enyl)-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5S,6R,7S)-6-N-(4-ethoxyphenyl)-3-(5-hydroxypentyl)-7-methyl-4-oxo-2-N-propan-2-yl-2-N,6-N-bis(prop-2-enyl)-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23952912 |
| Molecular Formula | C33H47N3O5S |
| Molecular Weight | 597.82 g/mol |
| Exact Mass | 597.32 |
| IUPAC Name | (5S,6R,7S)-6-N-(4-ethoxyphenyl)-3-(5-hydroxypentyl)-7-methyl-4-oxo-2-N-propan-2-yl-2-N,6-N-bis(prop-2-enyl)-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | C=CCN(C(=O)[C@H]1[C@H]2C(=O)N(CCCCCO)C(C(=O)N(CC=C)C(C)C)C23CC[C@]1(C)S3)c1ccc(OCC)cc1 |
| InChI | InChI=1S/C33H47N3O5S/c1-7-19-34(23(4)5)31(40)28-33-18-17-32(6,42-33)26(27(33)30(39)36(28)21-11-10-12-22-37)29(38)35(20-8-2)24-13-15-25(16-14-24)41-9-3/h7-8,13-16,23,26-28,37H,1-2,9-12,17-22H2,3-6H3/t26-,27+,28?,32+,33?/m1/s1 |
| InChIKey | PDHVCXUVKBDMFY-SUBYTZRVSA-N |
| XLogP | 4.67 |
| TPSA | 90.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.82 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|