C33H46N4O5S — CID 23953029
(5S,6R,7S)-6-N-benzyl-3-[(2S)-1-hydroxybutan-2-yl]-2-N-(2-morpholin-4-ylethyl)-4-oxo-2-N,6-N-bis(prop-2-enyl)-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23953029) has the molecular formula C33H46N4O5S and a molecular weight of 610.82 g/mol. Its IUPAC name is (5S,6R,7S)-6-N-benzyl-3-[(2S)-1-hydroxybutan-2-yl]-2-N-(2-morpholin-4-ylethyl)-4-oxo-2-N,6-N-bis(prop-2-enyl)-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5S,6R,7S)-6-N-benzyl-3-[(2S)-1-hydroxybutan-2-yl]-2-N-(2-morpholin-4-ylethyl)-4-oxo-2-N,6-N-bis(prop-2-enyl)-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23953029 |
| Molecular Formula | C33H46N4O5S |
| Molecular Weight | 610.82 g/mol |
| Exact Mass | 610.32 |
| IUPAC Name | (5S,6R,7S)-6-N-benzyl-3-[(2S)-1-hydroxybutan-2-yl]-2-N-(2-morpholin-4-ylethyl)-4-oxo-2-N,6-N-bis(prop-2-enyl)-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | C=CCN(CCN1CCOCC1)C(=O)C1N(C(CC)CO)C(=O)[C@@H]2[C@H](C(=O)N(CC=C)Cc3ccccc3)[C@@H]3CCC12S3 |
| InChI | InChI=1S/C33H46N4O5S/c1-4-14-35(17-16-34-18-20-42-21-19-34)32(41)29-33-13-12-26(43-33)27(28(33)31(40)37(29)25(6-3)23-38)30(39)36(15-5-2)22-24-10-8-7-9-11-24/h4-5,7-11,25-29,38H,1-2,6,12-23H2,3H3/t25?,26-,27+,28-,29?,33?/m0/s1 |
| InChIKey | HDSFACLGBOECQK-UHENYWOZSA-N |
| XLogP | 2.41 |
| TPSA | 93.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.82 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|