C22H27NO4S — CID 2395598
(2-oxo-2-pyrrolidin-1-ylethyl) 3-(cyclohexylsulfanylmethyl)-1-benzofuran-2-carboxylate (PubChem CID 2395598) has the molecular formula C22H27NO4S and a molecular weight of 401.53 g/mol. Its IUPAC name is (2-oxo-2-pyrrolidin-1-ylethyl) 3-(cyclohexylsulfanylmethyl)-1-benzofuran-2-carboxylate.
| Compound Name | (2-oxo-2-pyrrolidin-1-ylethyl) 3-(cyclohexylsulfanylmethyl)-1-benzofuran-2-carboxylate |
|---|---|
| PubChem CID | 2395598 |
| Molecular Formula | C22H27NO4S |
| Molecular Weight | 401.53 g/mol |
| Exact Mass | 401.17 |
| IUPAC Name | (2-oxo-2-pyrrolidin-1-ylethyl) 3-(cyclohexylsulfanylmethyl)-1-benzofuran-2-carboxylate |
| SMILES | O=C(OCC(=O)N1CCCC1)c1oc2ccccc2c1CSC1CCCCC1 |
| InChI | InChI=1S/C22H27NO4S/c24-20(23-12-6-7-13-23)14-26-22(25)21-18(15-28-16-8-2-1-3-9-16)17-10-4-5-11-19(17)27-21/h4-5,10-11,16H,1-3,6-9,12-15H2 |
| InChIKey | JFBIJMVWTVCVPD-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 59.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.53 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |