C28H34FN3O5Si — CID 23956240
N-[(3R,3'R,4'S,5'R)-4'-[fluoro(dimethyl)silyl]-5'-[2-[(2S)-2-(hydroxymethyl)pyrrolidin-1-yl]-2-oxoethyl]-3'-methyl-2-oxospiro[1H-indole-3,2'-oxolane]-5-yl]-N-phenylformamide (PubChem CID 23956240) has the molecular formula C28H34FN3O5Si and a molecular weight of 539.68 g/mol. Its IUPAC name is N-[(3R,3'R,4'S,5'R)-4'-[fluoro(dimethyl)silyl]-5'-[2-[(2S)-2-(hydroxymethyl)pyrrolidin-1-yl]-2-oxoethyl]-3'-methyl-2-oxospiro[1H-indole-3,2'-oxolane]-5-yl]-N-phenylformamide.
| Compound Name | N-[(3R,3'R,4'S,5'R)-4'-[fluoro(dimethyl)silyl]-5'-[2-[(2S)-2-(hydroxymethyl)pyrrolidin-1-yl]-2-oxoethyl]-3'-methyl-2-oxospiro[1H-indole-3,2'-oxolane]-5-yl]-N-phenylformamide |
|---|---|
| PubChem CID | 23956240 |
| Molecular Formula | C28H34FN3O5Si |
| Molecular Weight | 539.68 g/mol |
| Exact Mass | 539.23 |
| IUPAC Name | N-[(3R,3'R,4'S,5'R)-4'-[fluoro(dimethyl)silyl]-5'-[2-[(2S)-2-(hydroxymethyl)pyrrolidin-1-yl]-2-oxoethyl]-3'-methyl-2-oxospiro[1H-indole-3,2'-oxolane]-5-yl]-N-phenylformamide |
| SMILES | C[C@H]1[C@H]([Si](C)(C)F)[C@@H](CC(=O)N2CCC[C@H]2CO)O[C@]12C(=O)Nc1ccc(N(C=O)c3ccccc3)cc12 |
| InChI | InChI=1S/C28H34FN3O5Si/c1-18-26(38(2,3)29)24(15-25(35)31-13-7-10-21(31)16-33)37-28(18)22-14-20(11-12-23(22)30-27(28)36)32(17-34)19-8-5-4-6-9-19/h4-6,8-9,11-12,14,17-18,21,24,26,33H,7,10,13,15-16H2,1-3H3,(H,30,36)/t18-,21-,24+,26-,28+/m0/s1 |
| InChIKey | JZEDFQCDTJSZJC-AUTOORSOSA-N |
| XLogP | 4.08 |
| TPSA | 99.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.68 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|