C27H38BrFN2O6Si — CID 23956250
methyl 5-[(3R,3'R,4'S,5'R)-5-bromo-4'-[fluoro(dimethyl)silyl]-5'-[2-[(2S)-2-(hydroxymethyl)pyrrolidin-1-yl]-2-oxoethyl]-3'-methyl-2-oxospiro[indole-3,2'-oxolane]-1-yl]pentanoate (PubChem CID 23956250) has the molecular formula C27H38BrFN2O6Si and a molecular weight of 613.60 g/mol. Its IUPAC name is methyl 5-[(3R,3'R,4'S,5'R)-5-bromo-4'-[fluoro(dimethyl)silyl]-5'-[2-[(2S)-2-(hydroxymethyl)pyrrolidin-1-yl]-2-oxoethyl]-3'-methyl-2-oxospiro[indole-3,2'-oxolane]-1-yl]pentanoate.
| Compound Name | methyl 5-[(3R,3'R,4'S,5'R)-5-bromo-4'-[fluoro(dimethyl)silyl]-5'-[2-[(2S)-2-(hydroxymethyl)pyrrolidin-1-yl]-2-oxoethyl]-3'-methyl-2-oxospiro[indole-3,2'-oxolane]-1-yl]pentanoate |
|---|---|
| PubChem CID | 23956250 |
| Molecular Formula | C27H38BrFN2O6Si |
| Molecular Weight | 613.60 g/mol |
| Exact Mass | 612.17 |
| IUPAC Name | methyl 5-[(3R,3'R,4'S,5'R)-5-bromo-4'-[fluoro(dimethyl)silyl]-5'-[2-[(2S)-2-(hydroxymethyl)pyrrolidin-1-yl]-2-oxoethyl]-3'-methyl-2-oxospiro[indole-3,2'-oxolane]-1-yl]pentanoate |
| SMILES | COC(=O)CCCCN1C(=O)[C@]2(O[C@H](CC(=O)N3CCC[C@H]3CO)[C@@H]([Si](C)(C)F)[C@@H]2C)c2cc(Br)ccc21 |
| InChI | InChI=1S/C27H38BrFN2O6Si/c1-17-25(38(3,4)29)22(15-23(33)30-13-7-8-19(30)16-32)37-27(17)20-14-18(28)10-11-21(20)31(26(27)35)12-6-5-9-24(34)36-2/h10-11,14,17,19,22,25,32H,5-9,12-13,15-16H2,1-4H3/t17-,19-,22+,25-,27+/m0/s1 |
| InChIKey | RDDDWKMMDMPBPM-VBUMNVTQSA-N |
| XLogP | 4.29 |
| TPSA | 96.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.60 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|