C20H30FNO4Si — CID 23957578
1-[(2S,3S,4S)-2-[1-[fluoro(dimethyl)silyl]-3-hydroxypropyl]-4-methoxy-3-methyl-3,4-dihydro-2H-chromen-6-yl]pyrrolidin-2-one (PubChem CID 23957578) has the molecular formula C20H30FNO4Si and a molecular weight of 395.55 g/mol. Its IUPAC name is 1-[(2S,3S,4S)-2-[1-[fluoro(dimethyl)silyl]-3-hydroxypropyl]-4-methoxy-3-methyl-3,4-dihydro-2H-chromen-6-yl]pyrrolidin-2-one.
| Compound Name | 1-[(2S,3S,4S)-2-[1-[fluoro(dimethyl)silyl]-3-hydroxypropyl]-4-methoxy-3-methyl-3,4-dihydro-2H-chromen-6-yl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 23957578 |
| Molecular Formula | C20H30FNO4Si |
| Molecular Weight | 395.55 g/mol |
| Exact Mass | 395.19 |
| IUPAC Name | 1-[(2S,3S,4S)-2-[1-[fluoro(dimethyl)silyl]-3-hydroxypropyl]-4-methoxy-3-methyl-3,4-dihydro-2H-chromen-6-yl]pyrrolidin-2-one |
| SMILES | CO[C@@H]1c2cc(N3CCCC3=O)ccc2O[C@H](C(CCO)[Si](C)(C)F)[C@H]1C |
| InChI | InChI=1S/C20H30FNO4Si/c1-13-19(25-2)15-12-14(22-10-5-6-18(22)24)7-8-16(15)26-20(13)17(9-11-23)27(3,4)21/h7-8,12-13,17,19-20,23H,5-6,9-11H2,1-4H3/t13-,17?,19-,20-/m0/s1 |
| InChIKey | MZCIAAATNCMMPV-OHHTZVGLSA-N |
| XLogP | 3.83 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.55 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|