C33H39F17O5Si — CID 23958314
prop-2-enyl (E,4S,5R)-5-[4-[2-[3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecyl-di(propan-2-yl)silyl]oxyethoxy]phenyl]-5-hydroxy-4-methylpent-2-enoate (PubChem CID 23958314) has the molecular formula C33H39F17O5Si and a molecular weight of 866.72 g/mol. Its IUPAC name is prop-2-enyl (E,4S,5R)-5-[4-[2-[3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecyl-di(propan-2-yl)silyl]oxyethoxy]phenyl]-5-hydroxy-4-methylpent-2-enoate.
| Compound Name | prop-2-enyl (E,4S,5R)-5-[4-[2-[3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecyl-di(propan-2-yl)silyl]oxyethoxy]phenyl]-5-hydroxy-4-methylpent-2-enoate |
|---|---|
| PubChem CID | 23958314 |
| Molecular Formula | C33H39F17O5Si |
| Molecular Weight | 866.72 g/mol |
| Exact Mass | 866.23 |
| IUPAC Name | prop-2-enyl (E,4S,5R)-5-[4-[2-[3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecyl-di(propan-2-yl)silyl]oxyethoxy]phenyl]-5-hydroxy-4-methylpent-2-enoate |
| SMILES | C=CCOC(=O)/C=C/[C@H](C)[C@@H](O)c1ccc(OCCO[Si](CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)(C(C)C)C(C)C)cc1 |
| InChI | InChI=1S/C33H39F17O5Si/c1-7-15-54-24(51)13-8-21(6)25(52)22-9-11-23(12-10-22)53-16-17-55-56(19(2)3,20(4)5)18-14-26(34,35)27(36,37)28(38,39)29(40,41)30(42,43)31(44,45)32(46,47)33(48,49)50/h7-13,19-21,25,52H,1,14-18H2,2-6H3/b13-8+/t21-,25+/m0/s1 |
| InChIKey | LUFQUYPXSWDNFT-ACNCGDMISA-N |
| XLogP | 11.20 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 866.72 |
| LogP ≤ 5 | 11.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|