C22H22Cl2N6O6 — CID 23958871
3-[[(1-tert-butyltetrazol-5-yl)-(6-nitro-1,3-benzodioxol-5-yl)methyl]amino]-3-(3,4-dichlorophenyl)propanoic acid (PubChem CID 23958871) has the molecular formula C22H22Cl2N6O6 and a molecular weight of 537.36 g/mol. Its IUPAC name is 3-[[(1-tert-butyltetrazol-5-yl)-(6-nitro-1,3-benzodioxol-5-yl)methyl]amino]-3-(3,4-dichlorophenyl)propanoic acid.
| Compound Name | 3-[[(1-tert-butyltetrazol-5-yl)-(6-nitro-1,3-benzodioxol-5-yl)methyl]amino]-3-(3,4-dichlorophenyl)propanoic acid |
|---|---|
| PubChem CID | 23958871 |
| Molecular Formula | C22H22Cl2N6O6 |
| Molecular Weight | 537.36 g/mol |
| Exact Mass | 536.10 |
| IUPAC Name | 3-[[(1-tert-butyltetrazol-5-yl)-(6-nitro-1,3-benzodioxol-5-yl)methyl]amino]-3-(3,4-dichlorophenyl)propanoic acid |
| SMILES | CC(C)(C)n1nnnc1C(NC(CC(=O)O)c1ccc(Cl)c(Cl)c1)c1cc2c(cc1[N+](=O)[O-])OCO2 |
| InChI | InChI=1S/C22H22Cl2N6O6/c1-22(2,3)29-21(26-27-28-29)20(12-7-17-18(36-10-35-17)9-16(12)30(33)34)25-15(8-19(31)32)11-4-5-13(23)14(24)6-11/h4-7,9,15,20,25H,8,10H2,1-3H3,(H,31,32) |
| InChIKey | KMKIAGSTRWIJEM-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 154.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.36 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|