C15H22N2O4S — CID 23959675
ethyl 1-(2-pyridin-2-ylethylsulfonyl)piperidine-4-carboxylate (PubChem CID 23959675) has the molecular formula C15H22N2O4S and a molecular weight of 326.42 g/mol. Its IUPAC name is ethyl 1-(2-pyridin-2-ylethylsulfonyl)piperidine-4-carboxylate.
| Compound Name | ethyl 1-(2-pyridin-2-ylethylsulfonyl)piperidine-4-carboxylate |
|---|---|
| PubChem CID | 23959675 |
| Molecular Formula | C15H22N2O4S |
| Molecular Weight | 326.42 g/mol |
| Exact Mass | 326.13 |
| IUPAC Name | ethyl 1-(2-pyridin-2-ylethylsulfonyl)piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(S(=O)(=O)CCc2ccccn2)CC1 |
| InChI | InChI=1S/C15H22N2O4S/c1-2-21-15(18)13-6-10-17(11-7-13)22(19,20)12-8-14-5-3-4-9-16-14/h3-5,9,13H,2,6-8,10-12H2,1H3 |
| InChIKey | QOXDUBCTPYNVMQ-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 76.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.42 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |