C13H14ClNO4 — CID 23960179
methyl 1-[(2-chlorophenyl)methoxy]-5-oxopyrrolidine-3-carboxylate (PubChem CID 23960179) has the molecular formula C13H14ClNO4 and a molecular weight of 283.71 g/mol. Its IUPAC name is methyl 1-[(2-chlorophenyl)methoxy]-5-oxopyrrolidine-3-carboxylate.
| Compound Name | methyl 1-[(2-chlorophenyl)methoxy]-5-oxopyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 23960179 |
| Molecular Formula | C13H14ClNO4 |
| Molecular Weight | 283.71 g/mol |
| Exact Mass | 283.06 |
| IUPAC Name | methyl 1-[(2-chlorophenyl)methoxy]-5-oxopyrrolidine-3-carboxylate |
| SMILES | COC(=O)C1CC(=O)N(OCc2ccccc2Cl)C1 |
| InChI | InChI=1S/C13H14ClNO4/c1-18-13(17)10-6-12(16)15(7-10)19-8-9-4-2-3-5-11(9)14/h2-5,10H,6-8H2,1H3 |
| InChIKey | IFJRWAHHEKAMAE-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.71 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |