About 2-(2,6-dimethylpiperidin-1-yl)imino-1,2-diphenylethanone
2-(2,6-dimethylpiperidin-1-yl)imino-1,2-diphenylethanone (PubChem CID 23960497) has the molecular formula C21H24N2O
and a molecular weight of 320.44 g/mol. Its IUPAC name is 2-(2,6-dimethylpiperidin-1-yl)imino-1,2-diphenylethanone.
Molecular Properties
| Compound Name | 2-(2,6-dimethylpiperidin-1-yl)imino-1,2-diphenylethanone |
| PubChem CID | 23960497 |
| Molecular Formula | C21H24N2O |
| Molecular Weight | 320.44 g/mol |
| Exact Mass | 320.19 |
| IUPAC Name | 2-(2,6-dimethylpiperidin-1-yl)imino-1,2-diphenylethanone |
| SMILES | CC1CCCC(C)N1N=C(C(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H24N2O/c1-16-10-9-11-17(2)23(16)22-20(18-12-5-3-6-13-18)21(24)19-14-7-4-8-15-19/h3-8,12-17H,9-11H2,1-2H3 |
| InChIKey | RLNRICGMYNGLDO-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.44 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2-(2,6-dimethylpiperidin-1-yl)imino-1,2-diphenylethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,6-dimethylpiperidin-1-yl)imino-1,2-diphenylethanone?
The IUPAC name of 2-(2,6-dimethylpiperidin-1-yl)imino-1,2-diphenylethanone (CID 23960497) is 2-(2,6-dimethylpiperidin-1-yl)imino-1,2-diphenylethanone.
What is the SMILES notation for 2-(2,6-dimethylpiperidin-1-yl)imino-1,2-diphenylethanone?
The canonical SMILES for 2-(2,6-dimethylpiperidin-1-yl)imino-1,2-diphenylethanone is CC1CCCC(C)N1N=C(C(=O)c1ccccc1)c1ccccc1.
What is the InChIKey of 2-(2,6-dimethylpiperidin-1-yl)imino-1,2-diphenylethanone?
The InChIKey is RLNRICGMYNGLDO-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H24N2O/c1-16-10-9-11-17(2)23(16)22-20(18-12-5-3-6-13-18)21(24)19-14-7-4-8-15-19/h3-8,12-17H,9-11H2,1-2H3.
What are the key properties of 2-(2,6-dimethylpiperidin-1-yl)imino-1,2-diphenylethanone?
2-(2,6-dimethylpiperidin-1-yl)imino-1,2-diphenylethanone has a molecular weight of 320.44 g/mol, XLogP of 4.54, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,6-dimethylpiperidin-1-yl)imino-1,2-diphenylethanone is sourced from PubChem (CID 23960497), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).