About (2-amino-1,3-thiazol-4-yl)-(5,7-dichloro-1-benzofuran-2-yl)methanone
(2-amino-1,3-thiazol-4-yl)-(5,7-dichloro-1-benzofuran-2-yl)methanone (PubChem CID 23962006) has the molecular formula C12H6Cl2N2O2S
and a molecular weight of 313.17 g/mol. Its IUPAC name is (2-amino-1,3-thiazol-4-yl)-(5,7-dichloro-1-benzofuran-2-yl)methanone.
Molecular Properties
| Compound Name | (2-amino-1,3-thiazol-4-yl)-(5,7-dichloro-1-benzofuran-2-yl)methanone |
| PubChem CID | 23962006 |
| Molecular Formula | C12H6Cl2N2O2S |
| Molecular Weight | 313.17 g/mol |
| Exact Mass | 311.95 |
| IUPAC Name | (2-amino-1,3-thiazol-4-yl)-(5,7-dichloro-1-benzofuran-2-yl)methanone |
| SMILES | Nc1nc(C(=O)c2cc3cc(Cl)cc(Cl)c3o2)cs1 |
| InChI | InChI=1S/C12H6Cl2N2O2S/c13-6-1-5-2-9(18-11(5)7(14)3-6)10(17)8-4-19-12(15)16-8/h1-4H,(H2,15,16) |
| InChIKey | IUXQESYNQYANJF-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 69.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.17 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (2-amino-1,3-thiazol-4-yl)-(5,7-dichloro-1-benzofuran-2-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-amino-1,3-thiazol-4-yl)-(5,7-dichloro-1-benzofuran-2-yl)methanone?
The IUPAC name of (2-amino-1,3-thiazol-4-yl)-(5,7-dichloro-1-benzofuran-2-yl)methanone (CID 23962006) is (2-amino-1,3-thiazol-4-yl)-(5,7-dichloro-1-benzofuran-2-yl)methanone.
What is the SMILES notation for (2-amino-1,3-thiazol-4-yl)-(5,7-dichloro-1-benzofuran-2-yl)methanone?
The canonical SMILES for (2-amino-1,3-thiazol-4-yl)-(5,7-dichloro-1-benzofuran-2-yl)methanone is Nc1nc(C(=O)c2cc3cc(Cl)cc(Cl)c3o2)cs1.
What is the InChIKey of (2-amino-1,3-thiazol-4-yl)-(5,7-dichloro-1-benzofuran-2-yl)methanone?
The InChIKey is IUXQESYNQYANJF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H6Cl2N2O2S/c13-6-1-5-2-9(18-11(5)7(14)3-6)10(17)8-4-19-12(15)16-8/h1-4H,(H2,15,16).
What are the key properties of (2-amino-1,3-thiazol-4-yl)-(5,7-dichloro-1-benzofuran-2-yl)methanone?
(2-amino-1,3-thiazol-4-yl)-(5,7-dichloro-1-benzofuran-2-yl)methanone has a molecular weight of 313.17 g/mol, XLogP of 4.01, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2-amino-1,3-thiazol-4-yl)-(5,7-dichloro-1-benzofuran-2-yl)methanone is sourced from PubChem (CID 23962006), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).