About [2-oxo-2-(3-oxo-4H-1,4-benzoxazin-6-yl)ethyl] 2-(2,6-dimethylphenoxy)acetate
[2-oxo-2-(3-oxo-4H-1,4-benzoxazin-6-yl)ethyl] 2-(2,6-dimethylphenoxy)acetate (PubChem CID 2396297) has the molecular formula C20H19NO6
and a molecular weight of 369.37 g/mol. Its IUPAC name is [2-oxo-2-(3-oxo-4H-1,4-benzoxazin-6-yl)ethyl] 2-(2,6-dimethylphenoxy)acetate.
Molecular Properties
| Compound Name | [2-oxo-2-(3-oxo-4H-1,4-benzoxazin-6-yl)ethyl] 2-(2,6-dimethylphenoxy)acetate |
| PubChem CID | 2396297 |
| Molecular Formula | C20H19NO6 |
| Molecular Weight | 369.37 g/mol |
| Exact Mass | 369.12 |
| IUPAC Name | [2-oxo-2-(3-oxo-4H-1,4-benzoxazin-6-yl)ethyl] 2-(2,6-dimethylphenoxy)acetate |
| SMILES | Cc1cccc(C)c1OCC(=O)OCC(=O)c1ccc2c(c1)NC(=O)CO2 |
| InChI | InChI=1S/C20H19NO6/c1-12-4-3-5-13(2)20(12)27-11-19(24)26-9-16(22)14-6-7-17-15(8-14)21-18(23)10-25-17/h3-8H,9-11H2,1-2H3,(H,21,23) |
| InChIKey | OBQHZKQUWROSCV-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 369.37 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [2-oxo-2-(3-oxo-4H-1,4-benzoxazin-6-yl)ethyl] 2-(2,6-dimethylphenoxy)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-oxo-2-(3-oxo-4H-1,4-benzoxazin-6-yl)ethyl] 2-(2,6-dimethylphenoxy)acetate?
The IUPAC name of [2-oxo-2-(3-oxo-4H-1,4-benzoxazin-6-yl)ethyl] 2-(2,6-dimethylphenoxy)acetate (CID 2396297) is [2-oxo-2-(3-oxo-4H-1,4-benzoxazin-6-yl)ethyl] 2-(2,6-dimethylphenoxy)acetate.
What is the SMILES notation for [2-oxo-2-(3-oxo-4H-1,4-benzoxazin-6-yl)ethyl] 2-(2,6-dimethylphenoxy)acetate?
The canonical SMILES for [2-oxo-2-(3-oxo-4H-1,4-benzoxazin-6-yl)ethyl] 2-(2,6-dimethylphenoxy)acetate is Cc1cccc(C)c1OCC(=O)OCC(=O)c1ccc2c(c1)NC(=O)CO2.
What is the InChIKey of [2-oxo-2-(3-oxo-4H-1,4-benzoxazin-6-yl)ethyl] 2-(2,6-dimethylphenoxy)acetate?
The InChIKey is OBQHZKQUWROSCV-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H19NO6/c1-12-4-3-5-13(2)20(12)27-11-19(24)26-9-16(22)14-6-7-17-15(8-14)21-18(23)10-25-17/h3-8H,9-11H2,1-2H3,(H,21,23).
What are the key properties of [2-oxo-2-(3-oxo-4H-1,4-benzoxazin-6-yl)ethyl] 2-(2,6-dimethylphenoxy)acetate?
[2-oxo-2-(3-oxo-4H-1,4-benzoxazin-6-yl)ethyl] 2-(2,6-dimethylphenoxy)acetate has a molecular weight of 369.37 g/mol, XLogP of 2.44, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [2-oxo-2-(3-oxo-4H-1,4-benzoxazin-6-yl)ethyl] 2-(2,6-dimethylphenoxy)acetate is sourced from PubChem (CID 2396297), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).