About (1-ethylpiperidin-3-yl) 4,7,7-trimethyl-3-oxo-2-oxabicyclo[2.2.1]heptane-1-carboxylate
(1-ethylpiperidin-3-yl) 4,7,7-trimethyl-3-oxo-2-oxabicyclo[2.2.1]heptane-1-carboxylate (PubChem CID 23963304) has the molecular formula C17H27NO4
and a molecular weight of 309.41 g/mol. Its IUPAC name is (1-ethylpiperidin-3-yl) 4,7,7-trimethyl-3-oxo-2-oxabicyclo[2.2.1]heptane-1-carboxylate.
Molecular Properties
| Compound Name | (1-ethylpiperidin-3-yl) 4,7,7-trimethyl-3-oxo-2-oxabicyclo[2.2.1]heptane-1-carboxylate |
| PubChem CID | 23963304 |
| Molecular Formula | C17H27NO4 |
| Molecular Weight | 309.41 g/mol |
| Exact Mass | 309.19 |
| IUPAC Name | (1-ethylpiperidin-3-yl) 4,7,7-trimethyl-3-oxo-2-oxabicyclo[2.2.1]heptane-1-carboxylate |
| SMILES | CCN1CCCC(OC(=O)C23CCC(C)(C(=O)O2)C3(C)C)C1 |
| InChI | InChI=1S/C17H27NO4/c1-5-18-10-6-7-12(11-18)21-14(20)17-9-8-16(4,13(19)22-17)15(17,2)3/h12H,5-11H2,1-4H3 |
| InChIKey | WANVRKBPZNBTER-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.41 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (1-ethylpiperidin-3-yl) 4,7,7-trimethyl-3-oxo-2-oxabicyclo[2.2.1]heptane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-ethylpiperidin-3-yl) 4,7,7-trimethyl-3-oxo-2-oxabicyclo[2.2.1]heptane-1-carboxylate?
The IUPAC name of (1-ethylpiperidin-3-yl) 4,7,7-trimethyl-3-oxo-2-oxabicyclo[2.2.1]heptane-1-carboxylate (CID 23963304) is (1-ethylpiperidin-3-yl) 4,7,7-trimethyl-3-oxo-2-oxabicyclo[2.2.1]heptane-1-carboxylate.
What is the SMILES notation for (1-ethylpiperidin-3-yl) 4,7,7-trimethyl-3-oxo-2-oxabicyclo[2.2.1]heptane-1-carboxylate?
The canonical SMILES for (1-ethylpiperidin-3-yl) 4,7,7-trimethyl-3-oxo-2-oxabicyclo[2.2.1]heptane-1-carboxylate is CCN1CCCC(OC(=O)C23CCC(C)(C(=O)O2)C3(C)C)C1.
What is the InChIKey of (1-ethylpiperidin-3-yl) 4,7,7-trimethyl-3-oxo-2-oxabicyclo[2.2.1]heptane-1-carboxylate?
The InChIKey is WANVRKBPZNBTER-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H27NO4/c1-5-18-10-6-7-12(11-18)21-14(20)17-9-8-16(4,13(19)22-17)15(17,2)3/h12H,5-11H2,1-4H3.
What are the key properties of (1-ethylpiperidin-3-yl) 4,7,7-trimethyl-3-oxo-2-oxabicyclo[2.2.1]heptane-1-carboxylate?
(1-ethylpiperidin-3-yl) 4,7,7-trimethyl-3-oxo-2-oxabicyclo[2.2.1]heptane-1-carboxylate has a molecular weight of 309.41 g/mol, XLogP of 2.14, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (1-ethylpiperidin-3-yl) 4,7,7-trimethyl-3-oxo-2-oxabicyclo[2.2.1]heptane-1-carboxylate is sourced from PubChem (CID 23963304), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).