C21H20Cl2N2O4 — CID 23964487
dimethyl 3-amino-4-cyano-1-(2,5-dichlorophenyl)-6,7,8,8a-tetrahydro-1H-naphthalene-2,2-dicarboxylate (PubChem CID 23964487) has the molecular formula C21H20Cl2N2O4 and a molecular weight of 435.31 g/mol. Its IUPAC name is dimethyl 3-amino-4-cyano-1-(2,5-dichlorophenyl)-6,7,8,8a-tetrahydro-1H-naphthalene-2,2-dicarboxylate.
| Compound Name | dimethyl 3-amino-4-cyano-1-(2,5-dichlorophenyl)-6,7,8,8a-tetrahydro-1H-naphthalene-2,2-dicarboxylate |
|---|---|
| PubChem CID | 23964487 |
| Molecular Formula | C21H20Cl2N2O4 |
| Molecular Weight | 435.31 g/mol |
| Exact Mass | 434.08 |
| IUPAC Name | dimethyl 3-amino-4-cyano-1-(2,5-dichlorophenyl)-6,7,8,8a-tetrahydro-1H-naphthalene-2,2-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)C(N)=C(C#N)C2=CCCCC2C1c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C21H20Cl2N2O4/c1-28-19(26)21(20(27)29-2)17(14-9-11(22)7-8-16(14)23)13-6-4-3-5-12(13)15(10-24)18(21)25/h5,7-9,13,17H,3-4,6,25H2,1-2H3 |
| InChIKey | DFRXCBIXPPCFJN-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 102.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.31 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|