About 4-[2-(2,4-ditert-butyl-2H-pyran-6-yl)ethenyl]phenol
4-[2-(2,4-ditert-butyl-2H-pyran-6-yl)ethenyl]phenol (PubChem CID 23965021) has the molecular formula C21H28O2
and a molecular weight of 312.45 g/mol. Its IUPAC name is 4-[2-(2,4-ditert-butyl-2H-pyran-6-yl)ethenyl]phenol.
Molecular Properties
| Compound Name | 4-[2-(2,4-ditert-butyl-2H-pyran-6-yl)ethenyl]phenol |
| PubChem CID | 23965021 |
| Molecular Formula | C21H28O2 |
| Molecular Weight | 312.45 g/mol |
| Exact Mass | 312.21 |
| IUPAC Name | 4-[2-(2,4-ditert-butyl-2H-pyran-6-yl)ethenyl]phenol |
| SMILES | CC(C)(C)C1=CC(C(C)(C)C)OC(C=Cc2ccc(O)cc2)=C1 |
| InChI | InChI=1S/C21H28O2/c1-20(2,3)16-13-18(23-19(14-16)21(4,5)6)12-9-15-7-10-17(22)11-8-15/h7-14,19,22H,1-6H3 |
| InChIKey | UDCOLMSMCCKOIO-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 312.45 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-[2-(2,4-ditert-butyl-2H-pyran-6-yl)ethenyl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-(2,4-ditert-butyl-2H-pyran-6-yl)ethenyl]phenol?
The IUPAC name of 4-[2-(2,4-ditert-butyl-2H-pyran-6-yl)ethenyl]phenol (CID 23965021) is 4-[2-(2,4-ditert-butyl-2H-pyran-6-yl)ethenyl]phenol.
What is the SMILES notation for 4-[2-(2,4-ditert-butyl-2H-pyran-6-yl)ethenyl]phenol?
The canonical SMILES for 4-[2-(2,4-ditert-butyl-2H-pyran-6-yl)ethenyl]phenol is CC(C)(C)C1=CC(C(C)(C)C)OC(C=Cc2ccc(O)cc2)=C1.
What is the InChIKey of 4-[2-(2,4-ditert-butyl-2H-pyran-6-yl)ethenyl]phenol?
The InChIKey is UDCOLMSMCCKOIO-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H28O2/c1-20(2,3)16-13-18(23-19(14-16)21(4,5)6)12-9-15-7-10-17(22)11-8-15/h7-14,19,22H,1-6H3.
What are the key properties of 4-[2-(2,4-ditert-butyl-2H-pyran-6-yl)ethenyl]phenol?
4-[2-(2,4-ditert-butyl-2H-pyran-6-yl)ethenyl]phenol has a molecular weight of 312.45 g/mol, XLogP of 5.71, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-(2,4-ditert-butyl-2H-pyran-6-yl)ethenyl]phenol is sourced from PubChem (CID 23965021), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).