About 4-anilinobenzaldehyde
4-anilinobenzaldehyde (PubChem CID 2396509) has the molecular formula C13H11NO
and a molecular weight of 197.24 g/mol. Its IUPAC name is 4-anilinobenzaldehyde.
Molecular Properties
| Compound Name | 4-anilinobenzaldehyde |
| PubChem CID | 2396509 |
| Molecular Formula | C13H11NO |
| Molecular Weight | 197.24 g/mol |
| Exact Mass | 197.08 |
| IUPAC Name | 4-anilinobenzaldehyde |
| SMILES | O=Cc1ccc(Nc2ccccc2)cc1 |
| InChI | InChI=1S/C13H11NO/c15-10-11-6-8-13(9-7-11)14-12-4-2-1-3-5-12/h1-10,14H |
| InChIKey | XXWHZIJHYNPASE-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.24 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 4-anilinobenzaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-anilinobenzaldehyde?
The IUPAC name of 4-anilinobenzaldehyde (CID 2396509) is 4-anilinobenzaldehyde.
What is the SMILES notation for 4-anilinobenzaldehyde?
The canonical SMILES for 4-anilinobenzaldehyde is O=Cc1ccc(Nc2ccccc2)cc1.
What is the InChIKey of 4-anilinobenzaldehyde?
The InChIKey is XXWHZIJHYNPASE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11NO/c15-10-11-6-8-13(9-7-11)14-12-4-2-1-3-5-12/h1-10,14H.
What are the key properties of 4-anilinobenzaldehyde?
4-anilinobenzaldehyde has a molecular weight of 197.24 g/mol, XLogP of 3.24, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-anilinobenzaldehyde is sourced from PubChem (CID 2396509), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).