C12H11N3O2 — CID 23965140
2-pyrimidin-2-yl-3a,4,7,7a-tetrahydroisoindole-1,3-dione (PubChem CID 23965140) has the molecular formula C12H11N3O2 and a molecular weight of 229.24 g/mol. Its IUPAC name is 2-pyrimidin-2-yl-3a,4,7,7a-tetrahydroisoindole-1,3-dione.
| Compound Name | 2-pyrimidin-2-yl-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 23965140 |
| Molecular Formula | C12H11N3O2 |
| Molecular Weight | 229.24 g/mol |
| Exact Mass | 229.09 |
| IUPAC Name | 2-pyrimidin-2-yl-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
| SMILES | O=C1C2CC=CCC2C(=O)N1c1ncccn1 |
| InChI | InChI=1S/C12H11N3O2/c16-10-8-4-1-2-5-9(8)11(17)15(10)12-13-6-3-7-14-12/h1-3,6-9H,4-5H2 |
| InChIKey | IMPSJZVZHMZEKZ-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 63.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.24 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|