C16H13Cl2N3OS — CID 23966153
4-(2,4-dichlorophenyl)-3-[1-(furan-2-yl)ethylideneamino]-N-methyl-1,3-thiazol-2-imine (PubChem CID 23966153) has the molecular formula C16H13Cl2N3OS and a molecular weight of 366.27 g/mol. Its IUPAC name is 4-(2,4-dichlorophenyl)-3-[1-(furan-2-yl)ethylideneamino]-N-methyl-1,3-thiazol-2-imine.
| Compound Name | 4-(2,4-dichlorophenyl)-3-[1-(furan-2-yl)ethylideneamino]-N-methyl-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 23966153 |
| Molecular Formula | C16H13Cl2N3OS |
| Molecular Weight | 366.27 g/mol |
| Exact Mass | 365.02 |
| IUPAC Name | 4-(2,4-dichlorophenyl)-3-[1-(furan-2-yl)ethylideneamino]-N-methyl-1,3-thiazol-2-imine |
| SMILES | C/N=c1\scc(-c2ccc(Cl)cc2Cl)n1N=C(C)c1ccco1 |
| InChI | InChI=1S/C16H13Cl2N3OS/c1-10(15-4-3-7-22-15)20-21-14(9-23-16(21)19-2)12-6-5-11(17)8-13(12)18/h3-9H,1-2H3/b19-16-,20-10? |
| InChIKey | MVFFGWJVCLFTIU-ZDPFTQJASA-N |
| XLogP | 4.92 |
| TPSA | 42.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.27 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|