C16H22Cl2N2O2 — CID 23967386
4,5-dichloro-1-N,2-N-bis(2-methylpropyl)benzene-1,2-dicarboxamide (PubChem CID 23967386) has the molecular formula C16H22Cl2N2O2 and a molecular weight of 345.27 g/mol. Its IUPAC name is 4,5-dichloro-1-N,2-N-bis(2-methylpropyl)benzene-1,2-dicarboxamide.
| Compound Name | 4,5-dichloro-1-N,2-N-bis(2-methylpropyl)benzene-1,2-dicarboxamide |
|---|---|
| PubChem CID | 23967386 |
| Molecular Formula | C16H22Cl2N2O2 |
| Molecular Weight | 345.27 g/mol |
| Exact Mass | 344.11 |
| IUPAC Name | 4,5-dichloro-1-N,2-N-bis(2-methylpropyl)benzene-1,2-dicarboxamide |
| SMILES | CC(C)CNC(=O)c1cc(Cl)c(Cl)cc1C(=O)NCC(C)C |
| InChI | InChI=1S/C16H22Cl2N2O2/c1-9(2)7-19-15(21)11-5-13(17)14(18)6-12(11)16(22)20-8-10(3)4/h5-6,9-10H,7-8H2,1-4H3,(H,19,21)(H,20,22) |
| InChIKey | RZFVXFLUUWWMLT-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.27 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |