C19H13F4N3O3 — CID 23972260
[1-oxo-1-(2,3,5,6-tetrafluoroanilino)butan-2-yl] quinoxaline-2-carboxylate (PubChem CID 23972260) has the molecular formula C19H13F4N3O3 and a molecular weight of 407.32 g/mol. Its IUPAC name is [1-oxo-1-(2,3,5,6-tetrafluoroanilino)butan-2-yl] quinoxaline-2-carboxylate.
| Compound Name | [1-oxo-1-(2,3,5,6-tetrafluoroanilino)butan-2-yl] quinoxaline-2-carboxylate |
|---|---|
| PubChem CID | 23972260 |
| Molecular Formula | C19H13F4N3O3 |
| Molecular Weight | 407.32 g/mol |
| Exact Mass | 407.09 |
| IUPAC Name | [1-oxo-1-(2,3,5,6-tetrafluoroanilino)butan-2-yl] quinoxaline-2-carboxylate |
| SMILES | CCC(OC(=O)c1cnc2ccccc2n1)C(=O)Nc1c(F)c(F)cc(F)c1F |
| InChI | InChI=1S/C19H13F4N3O3/c1-2-14(18(27)26-17-15(22)9(20)7-10(21)16(17)23)29-19(28)13-8-24-11-5-3-4-6-12(11)25-13/h3-8,14H,2H2,1H3,(H,26,27) |
| InChIKey | ROBVTZHMEBLHOL-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.32 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|