About cyanomethyl (2S)-2-(1,3-dioxoisoindol-2-yl)-3-phenylpropanoate
cyanomethyl (2S)-2-(1,3-dioxoisoindol-2-yl)-3-phenylpropanoate (PubChem CID 2397430) has the molecular formula C19H14N2O4
and a molecular weight of 334.33 g/mol. Its IUPAC name is cyanomethyl (2S)-2-(1,3-dioxoisoindol-2-yl)-3-phenylpropanoate.
Molecular Properties
| Compound Name | cyanomethyl (2S)-2-(1,3-dioxoisoindol-2-yl)-3-phenylpropanoate |
| PubChem CID | 2397430 |
| Molecular Formula | C19H14N2O4 |
| Molecular Weight | 334.33 g/mol |
| Exact Mass | 334.10 |
| IUPAC Name | cyanomethyl (2S)-2-(1,3-dioxoisoindol-2-yl)-3-phenylpropanoate |
| SMILES | N#CCOC(=O)[C@H](Cc1ccccc1)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C19H14N2O4/c20-10-11-25-19(24)16(12-13-6-2-1-3-7-13)21-17(22)14-8-4-5-9-15(14)18(21)23/h1-9,16H,11-12H2/t16-/m0/s1 |
| InChIKey | REWDDNAJJLCTMA-INIZCTEOSA-N |
| XLogP | 1.96 |
| TPSA | 87.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.33 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze cyanomethyl (2S)-2-(1,3-dioxoisoindol-2-yl)-3-phenylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyanomethyl (2S)-2-(1,3-dioxoisoindol-2-yl)-3-phenylpropanoate?
The IUPAC name of cyanomethyl (2S)-2-(1,3-dioxoisoindol-2-yl)-3-phenylpropanoate (CID 2397430) is cyanomethyl (2S)-2-(1,3-dioxoisoindol-2-yl)-3-phenylpropanoate.
What is the SMILES notation for cyanomethyl (2S)-2-(1,3-dioxoisoindol-2-yl)-3-phenylpropanoate?
The canonical SMILES for cyanomethyl (2S)-2-(1,3-dioxoisoindol-2-yl)-3-phenylpropanoate is N#CCOC(=O)[C@H](Cc1ccccc1)N1C(=O)c2ccccc2C1=O.
What is the InChIKey of cyanomethyl (2S)-2-(1,3-dioxoisoindol-2-yl)-3-phenylpropanoate?
The InChIKey is REWDDNAJJLCTMA-INIZCTEOSA-N. The full InChI is InChI=1S/C19H14N2O4/c20-10-11-25-19(24)16(12-13-6-2-1-3-7-13)21-17(22)14-8-4-5-9-15(14)18(21)23/h1-9,16H,11-12H2/t16-/m0/s1.
What are the key properties of cyanomethyl (2S)-2-(1,3-dioxoisoindol-2-yl)-3-phenylpropanoate?
cyanomethyl (2S)-2-(1,3-dioxoisoindol-2-yl)-3-phenylpropanoate has a molecular weight of 334.33 g/mol, XLogP of 1.96, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for cyanomethyl (2S)-2-(1,3-dioxoisoindol-2-yl)-3-phenylpropanoate is sourced from PubChem (CID 2397430), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).