C30H31FN2O6 — CID 23974712
(3R,5aR,8aS,8bR)-3-[(E)-4-(3-fluoro-4-hydroxyphenyl)-3-methylbut-3-enyl]-7-(3-nitrophenyl)-4-propan-2-yl-1,3,5,5a,8a,8b-hexahydrofuro[3,4-e]isoindole-6,8-dione (PubChem CID 23974712) has the molecular formula C30H31FN2O6 and a molecular weight of 534.58 g/mol. Its IUPAC name is (3R,5aR,8aS,8bR)-3-[(E)-4-(3-fluoro-4-hydroxyphenyl)-3-methylbut-3-enyl]-7-(3-nitrophenyl)-4-propan-2-yl-1,3,5,5a,8a,8b-hexahydrofuro[3,4-e]isoindole-6,8-dione.
| Compound Name | (3R,5aR,8aS,8bR)-3-[(E)-4-(3-fluoro-4-hydroxyphenyl)-3-methylbut-3-enyl]-7-(3-nitrophenyl)-4-propan-2-yl-1,3,5,5a,8a,8b-hexahydrofuro[3,4-e]isoindole-6,8-dione |
|---|---|
| PubChem CID | 23974712 |
| Molecular Formula | C30H31FN2O6 |
| Molecular Weight | 534.58 g/mol |
| Exact Mass | 534.22 |
| IUPAC Name | (3R,5aR,8aS,8bR)-3-[(E)-4-(3-fluoro-4-hydroxyphenyl)-3-methylbut-3-enyl]-7-(3-nitrophenyl)-4-propan-2-yl-1,3,5,5a,8a,8b-hexahydrofuro[3,4-e]isoindole-6,8-dione |
| SMILES | C/C(=C\c1ccc(O)c(F)c1)CC[C@H]1OC[C@H]2C1=C(C(C)C)C[C@H]1C(=O)N(c3cccc([N+](=O)[O-])c3)C(=O)[C@H]12 |
| InChI | InChI=1S/C30H31FN2O6/c1-16(2)21-14-22-28(30(36)32(29(22)35)19-5-4-6-20(13-19)33(37)38)23-15-39-26(27(21)23)10-7-17(3)11-18-8-9-25(34)24(31)12-18/h4-6,8-9,11-13,16,22-23,26,28,34H,7,10,14-15H2,1-3H3/b17-11+/t22-,23+,26-,28-/m1/s1 |
| InChIKey | GSEDRYJYYSFWGP-XIXHIDFDSA-N |
| XLogP | 5.80 |
| TPSA | 109.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.58 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|