C24H26FNO5S — CID 23975017
(3aS,5S,5aR,7S,8aS,8bR)-7-(3-fluoro-4-hydroxyphenyl)-5a-hydroxy-5-propyl-2-(thiophen-2-ylmethyl)-4,5,7,8,8a,8b-hexahydro-3aH-furo[3,2-e]isoindole-1,3-dione (PubChem CID 23975017) has the molecular formula C24H26FNO5S and a molecular weight of 459.54 g/mol. Its IUPAC name is (3aS,5S,5aR,7S,8aS,8bR)-7-(3-fluoro-4-hydroxyphenyl)-5a-hydroxy-5-propyl-2-(thiophen-2-ylmethyl)-4,5,7,8,8a,8b-hexahydro-3aH-furo[3,2-e]isoindole-1,3-dione.
| Compound Name | (3aS,5S,5aR,7S,8aS,8bR)-7-(3-fluoro-4-hydroxyphenyl)-5a-hydroxy-5-propyl-2-(thiophen-2-ylmethyl)-4,5,7,8,8a,8b-hexahydro-3aH-furo[3,2-e]isoindole-1,3-dione |
|---|---|
| PubChem CID | 23975017 |
| Molecular Formula | C24H26FNO5S |
| Molecular Weight | 459.54 g/mol |
| Exact Mass | 459.15 |
| IUPAC Name | (3aS,5S,5aR,7S,8aS,8bR)-7-(3-fluoro-4-hydroxyphenyl)-5a-hydroxy-5-propyl-2-(thiophen-2-ylmethyl)-4,5,7,8,8a,8b-hexahydro-3aH-furo[3,2-e]isoindole-1,3-dione |
| SMILES | CCC[C@H]1C[C@@H]2C(=O)N(Cc3cccs3)C(=O)[C@@H]2[C@@H]2C[C@@H](c3ccc(O)c(F)c3)O[C@]12O |
| InChI | InChI=1S/C24H26FNO5S/c1-2-4-14-10-16-21(23(29)26(22(16)28)12-15-5-3-8-32-15)17-11-20(31-24(14,17)30)13-6-7-19(27)18(25)9-13/h3,5-9,14,16-17,20-21,27,30H,2,4,10-12H2,1H3/t14-,16-,17-,20-,21-,24+/m0/s1 |
| InChIKey | MCRSZTSEHWPXPJ-DGQPXHSTSA-N |
| XLogP | 3.98 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.54 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|