C27H31FN4O5 — CID 23975055
(3S,6R,7S,8aS)-3-(4-acetamidobutyl)-N-[(4-fluorophenyl)methyl]-6-(4-hydroxyphenyl)-1,4-dioxo-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-7-carboxamide (PubChem CID 23975055) has the molecular formula C27H31FN4O5 and a molecular weight of 510.57 g/mol. Its IUPAC name is (3S,6R,7S,8aS)-3-(4-acetamidobutyl)-N-[(4-fluorophenyl)methyl]-6-(4-hydroxyphenyl)-1,4-dioxo-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-7-carboxamide.
| Compound Name | (3S,6R,7S,8aS)-3-(4-acetamidobutyl)-N-[(4-fluorophenyl)methyl]-6-(4-hydroxyphenyl)-1,4-dioxo-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-7-carboxamide |
|---|---|
| PubChem CID | 23975055 |
| Molecular Formula | C27H31FN4O5 |
| Molecular Weight | 510.57 g/mol |
| Exact Mass | 510.23 |
| IUPAC Name | (3S,6R,7S,8aS)-3-(4-acetamidobutyl)-N-[(4-fluorophenyl)methyl]-6-(4-hydroxyphenyl)-1,4-dioxo-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-7-carboxamide |
| SMILES | CC(=O)NCCCC[C@@H]1NC(=O)[C@@H]2C[C@H](C(=O)NCc3ccc(F)cc3)[C@H](c3ccc(O)cc3)N2C1=O |
| InChI | InChI=1S/C27H31FN4O5/c1-16(33)29-13-3-2-4-22-27(37)32-23(26(36)31-22)14-21(24(32)18-7-11-20(34)12-8-18)25(35)30-15-17-5-9-19(28)10-6-17/h5-12,21-24,34H,2-4,13-15H2,1H3,(H,29,33)(H,30,35)(H,31,36)/t21-,22-,23-,24-/m0/s1 |
| InChIKey | YOUIBHGWJRPNHW-ZJZGAYNASA-N |
| XLogP | 1.91 |
| TPSA | 127.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.57 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|