C12H14BrNO4 — CID 23976307
(E,4R,5R)-5-(5-bromo-2-hydroxyphenyl)-N,5-dihydroxy-4-methylpent-2-enamide (PubChem CID 23976307) has the molecular formula C12H14BrNO4 and a molecular weight of 316.15 g/mol. Its IUPAC name is (E,4R,5R)-5-(5-bromo-2-hydroxyphenyl)-N,5-dihydroxy-4-methylpent-2-enamide.
| Compound Name | (E,4R,5R)-5-(5-bromo-2-hydroxyphenyl)-N,5-dihydroxy-4-methylpent-2-enamide |
|---|---|
| PubChem CID | 23976307 |
| Molecular Formula | C12H14BrNO4 |
| Molecular Weight | 316.15 g/mol |
| Exact Mass | 315.01 |
| IUPAC Name | (E,4R,5R)-5-(5-bromo-2-hydroxyphenyl)-N,5-dihydroxy-4-methylpent-2-enamide |
| SMILES | C[C@H](/C=C/C(=O)NO)[C@@H](O)c1cc(Br)ccc1O |
| InChI | InChI=1S/C12H14BrNO4/c1-7(2-5-11(16)14-18)12(17)9-6-8(13)3-4-10(9)15/h2-7,12,15,17-18H,1H3,(H,14,16)/b5-2+/t7-,12-/m1/s1 |
| InChIKey | IEMNECMWXFAPBG-VFEKNHMASA-N |
| XLogP | 1.89 |
| TPSA | 89.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.15 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|