C32H32IN3O4 — CID 23976618
[(E,1R)-7-(2-aminoanilino)-1-(2-hydroxy-5-iodophenyl)-2,2-dimethyl-7-oxohept-5-enyl] N-naphthalen-1-ylcarbamate (PubChem CID 23976618) has the molecular formula C32H32IN3O4 and a molecular weight of 649.53 g/mol. Its IUPAC name is [(E,1R)-7-(2-aminoanilino)-1-(2-hydroxy-5-iodophenyl)-2,2-dimethyl-7-oxohept-5-enyl] N-naphthalen-1-ylcarbamate.
| Compound Name | [(E,1R)-7-(2-aminoanilino)-1-(2-hydroxy-5-iodophenyl)-2,2-dimethyl-7-oxohept-5-enyl] N-naphthalen-1-ylcarbamate |
|---|---|
| PubChem CID | 23976618 |
| Molecular Formula | C32H32IN3O4 |
| Molecular Weight | 649.53 g/mol |
| Exact Mass | 649.14 |
| IUPAC Name | [(E,1R)-7-(2-aminoanilino)-1-(2-hydroxy-5-iodophenyl)-2,2-dimethyl-7-oxohept-5-enyl] N-naphthalen-1-ylcarbamate |
| SMILES | CC(C)(CC/C=C/C(=O)Nc1ccccc1N)[C@@H](OC(=O)Nc1cccc2ccccc12)c1cc(I)ccc1O |
| InChI | InChI=1S/C32H32IN3O4/c1-32(2,19-8-7-16-29(38)35-27-14-6-5-13-25(27)34)30(24-20-22(33)17-18-28(24)37)40-31(39)36-26-15-9-11-21-10-3-4-12-23(21)26/h3-7,9-18,20,30,37H,8,19,34H2,1-2H3,(H,35,38)(H,36,39)/b16-7+/t30-/m0/s1 |
| InChIKey | LOZHXSKYCPYNLN-JXEPSOFOSA-N |
| XLogP | 8.02 |
| TPSA | 113.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.53 |
| LogP ≤ 5 | 8.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|