C18H15N3O5S2 — CID 2397848
N-[2-[(5Z)-2,4-dioxo-5-(thiophen-2-ylmethylidene)-1,3-thiazolidin-3-yl]ethyl]-2-methyl-3-nitrobenzamide (PubChem CID 2397848) has the molecular formula C18H15N3O5S2 and a molecular weight of 417.47 g/mol. Its IUPAC name is N-[2-[(5Z)-2,4-dioxo-5-(thiophen-2-ylmethylidene)-1,3-thiazolidin-3-yl]ethyl]-2-methyl-3-nitrobenzamide.
| Compound Name | N-[2-[(5Z)-2,4-dioxo-5-(thiophen-2-ylmethylidene)-1,3-thiazolidin-3-yl]ethyl]-2-methyl-3-nitrobenzamide |
|---|---|
| PubChem CID | 2397848 |
| Molecular Formula | C18H15N3O5S2 |
| Molecular Weight | 417.47 g/mol |
| Exact Mass | 417.05 |
| IUPAC Name | N-[2-[(5Z)-2,4-dioxo-5-(thiophen-2-ylmethylidene)-1,3-thiazolidin-3-yl]ethyl]-2-methyl-3-nitrobenzamide |
| SMILES | Cc1c(C(=O)NCCN2C(=O)S/C(=C\c3cccs3)C2=O)cccc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H15N3O5S2/c1-11-13(5-2-6-14(11)21(25)26)16(22)19-7-8-20-17(23)15(28-18(20)24)10-12-4-3-9-27-12/h2-6,9-10H,7-8H2,1H3,(H,19,22)/b15-10- |
| InChIKey | AAPUXBODJIJXSY-GDNBJRDFSA-N |
| XLogP | 3.43 |
| TPSA | 109.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.47 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|