C29H43N3O5 — CID 23980100
(5R,6S,7S)-6-N-benzyl-2-N-butyl-7-ethyl-3-[(2R,3S)-1-hydroxy-3-methylpentan-2-yl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23980100) has the molecular formula C29H43N3O5 and a molecular weight of 513.68 g/mol. Its IUPAC name is (5R,6S,7S)-6-N-benzyl-2-N-butyl-7-ethyl-3-[(2R,3S)-1-hydroxy-3-methylpentan-2-yl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5R,6S,7S)-6-N-benzyl-2-N-butyl-7-ethyl-3-[(2R,3S)-1-hydroxy-3-methylpentan-2-yl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23980100 |
| Molecular Formula | C29H43N3O5 |
| Molecular Weight | 513.68 g/mol |
| Exact Mass | 513.32 |
| IUPAC Name | (5R,6S,7S)-6-N-benzyl-2-N-butyl-7-ethyl-3-[(2R,3S)-1-hydroxy-3-methylpentan-2-yl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | CCCCNC(=O)C1N([C@@H](CO)[C@@H](C)CC)C(=O)[C@@H]2[C@H](C(=O)NCc3ccccc3)[C@]3(CC)CCC12O3 |
| InChI | InChI=1S/C29H43N3O5/c1-5-8-16-30-26(35)24-29-15-14-28(7-3,37-29)22(25(34)31-17-20-12-10-9-11-13-20)23(29)27(36)32(24)21(18-33)19(4)6-2/h9-13,19,21-24,33H,5-8,14-18H2,1-4H3,(H,30,35)(H,31,34)/t19-,21-,22+,23-,24?,28-,29?/m0/s1 |
| InChIKey | QNJJKTDCKFYHCT-VRDLJTBESA-N |
| XLogP | 2.78 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.68 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|