C30H37N3O6 — CID 23980133
(5R,6S,7S)-6-N-benzyl-3-[(2R)-1-hydroxy-4-methylpentan-2-yl]-2-N-(4-methoxyphenyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23980133) has the molecular formula C30H37N3O6 and a molecular weight of 535.64 g/mol. Its IUPAC name is (5R,6S,7S)-6-N-benzyl-3-[(2R)-1-hydroxy-4-methylpentan-2-yl]-2-N-(4-methoxyphenyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5R,6S,7S)-6-N-benzyl-3-[(2R)-1-hydroxy-4-methylpentan-2-yl]-2-N-(4-methoxyphenyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23980133 |
| Molecular Formula | C30H37N3O6 |
| Molecular Weight | 535.64 g/mol |
| Exact Mass | 535.27 |
| IUPAC Name | (5R,6S,7S)-6-N-benzyl-3-[(2R)-1-hydroxy-4-methylpentan-2-yl]-2-N-(4-methoxyphenyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | COc1ccc(NC(=O)C2N(C(CO)CC(C)C)C(=O)[C@@H]3[C@H](C(=O)NCc4ccccc4)[C@@H]4CCC23O4)cc1 |
| InChI | InChI=1S/C30H37N3O6/c1-18(2)15-21(17-34)33-26(28(36)32-20-9-11-22(38-3)12-10-20)30-14-13-23(39-30)24(25(30)29(33)37)27(35)31-16-19-7-5-4-6-8-19/h4-12,18,21,23-26,34H,13-17H2,1-3H3,(H,31,35)(H,32,36)/t21?,23-,24+,25-,26?,30?/m0/s1 |
| InChIKey | ISKKDJKLPWFAGR-DKJOZMGLSA-N |
| XLogP | 2.73 |
| TPSA | 117.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.64 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |