C7H10N2O3 — CID 2398144
1-(2-methylpropyl)imidazolidine-2,4,5-trione (PubChem CID 2398144) has the molecular formula C7H10N2O3 and a molecular weight of 170.17 g/mol. Its IUPAC name is 1-(2-methylpropyl)imidazolidine-2,4,5-trione.
| Compound Name | 1-(2-methylpropyl)imidazolidine-2,4,5-trione |
|---|---|
| PubChem CID | 2398144 |
| Molecular Formula | C7H10N2O3 |
| Molecular Weight | 170.17 g/mol |
| Exact Mass | 170.07 |
| IUPAC Name | 1-(2-methylpropyl)imidazolidine-2,4,5-trione |
| SMILES | CC(C)CN1C(=O)NC(=O)C1=O |
| InChI | InChI=1S/C7H10N2O3/c1-4(2)3-9-6(11)5(10)8-7(9)12/h4H,3H2,1-2H3,(H,8,10,12) |
| InChIKey | IPVNATUOTSZSAT-UHFFFAOYSA-N |
| XLogP | -0.28 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.17 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|