C20H20O5 — CID 23983654
(1R,4R,4'R,5R)-4'-ethenyl-1,4',10'-trimethylspiro[3,6-dioxabicyclo[3.1.0]hexane-4,2'-3H-pyrano[3,2-c]chromene]-5'-one (PubChem CID 23983654) has the molecular formula C20H20O5 and a molecular weight of 340.38 g/mol. Its IUPAC name is (1R,4R,4'R,5R)-4'-ethenyl-1,4',10'-trimethylspiro[3,6-dioxabicyclo[3.1.0]hexane-4,2'-3H-pyrano[3,2-c]chromene]-5'-one.
| Compound Name | (1R,4R,4'R,5R)-4'-ethenyl-1,4',10'-trimethylspiro[3,6-dioxabicyclo[3.1.0]hexane-4,2'-3H-pyrano[3,2-c]chromene]-5'-one |
|---|---|
| PubChem CID | 23983654 |
| Molecular Formula | C20H20O5 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.13 |
| IUPAC Name | (1R,4R,4'R,5R)-4'-ethenyl-1,4',10'-trimethylspiro[3,6-dioxabicyclo[3.1.0]hexane-4,2'-3H-pyrano[3,2-c]chromene]-5'-one |
| SMILES | C=C[C@@]1(C)C[C@@]2(OC[C@@]3(C)O[C@@H]23)Oc2c1c(=O)oc1cccc(C)c21 |
| InChI | InChI=1S/C20H20O5/c1-5-18(3)9-20(17-19(4,25-17)10-22-20)24-15-13-11(2)7-6-8-12(13)23-16(21)14(15)18/h5-8,17H,1,9-10H2,2-4H3/t17-,18+,19-,20-/m1/s1 |
| InChIKey | AWNULKZWGIHZJH-IYWMVGAKSA-N |
| XLogP | 3.21 |
| TPSA | 61.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|