C12H16N2 — CID 23983770
3,4,6,6a,7,8-hexahydrobenzo[c]indol-7-amine (PubChem CID 23983770) has the molecular formula C12H16N2 and a molecular weight of 188.27 g/mol. Its IUPAC name is 3,4,6,6a,7,8-hexahydrobenzo[c]indol-7-amine.
| Compound Name | 3,4,6,6a,7,8-hexahydrobenzo[c]indol-7-amine |
|---|---|
| PubChem CID | 23983770 |
| Molecular Formula | C12H16N2 |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.13 |
| IUPAC Name | 3,4,6,6a,7,8-hexahydrobenzo[c]indol-7-amine |
| SMILES | NC1CC=CC23C=CCCC2=NCC13 |
| InChI | InChI=1S/C12H16N2/c13-10-4-3-7-12-6-2-1-5-11(12)14-8-9(10)12/h2-3,6-7,9-10H,1,4-5,8,13H2 |
| InChIKey | HKBLSRDHGAXOEZ-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|