C29H38N2O6Si — CID 23983973
N-benzyl-2-[(2'R,3R,3'S,4'R)-3'-[hydroxy(dimethyl)silyl]-5-methoxy-4'-methyl-2-oxo-1-prop-2-enylspiro[indole-3,5'-oxolane]-2'-yl]-N-(2-hydroxyethyl)acetamide (PubChem CID 23983973) has the molecular formula C29H38N2O6Si and a molecular weight of 538.72 g/mol. Its IUPAC name is N-benzyl-2-[(2'R,3R,3'S,4'R)-3'-[hydroxy(dimethyl)silyl]-5-methoxy-4'-methyl-2-oxo-1-prop-2-enylspiro[indole-3,5'-oxolane]-2'-yl]-N-(2-hydroxyethyl)acetamide.
| Compound Name | N-benzyl-2-[(2'R,3R,3'S,4'R)-3'-[hydroxy(dimethyl)silyl]-5-methoxy-4'-methyl-2-oxo-1-prop-2-enylspiro[indole-3,5'-oxolane]-2'-yl]-N-(2-hydroxyethyl)acetamide |
|---|---|
| PubChem CID | 23983973 |
| Molecular Formula | C29H38N2O6Si |
| Molecular Weight | 538.72 g/mol |
| Exact Mass | 538.25 |
| IUPAC Name | N-benzyl-2-[(2'R,3R,3'S,4'R)-3'-[hydroxy(dimethyl)silyl]-5-methoxy-4'-methyl-2-oxo-1-prop-2-enylspiro[indole-3,5'-oxolane]-2'-yl]-N-(2-hydroxyethyl)acetamide |
| SMILES | C=CCN1C(=O)[C@]2(O[C@H](CC(=O)N(CCO)Cc3ccccc3)[C@@H]([Si](C)(C)O)[C@@H]2C)c2cc(OC)ccc21 |
| InChI | InChI=1S/C29H38N2O6Si/c1-6-14-31-24-13-12-22(36-3)17-23(24)29(28(31)34)20(2)27(38(4,5)35)25(37-29)18-26(33)30(15-16-32)19-21-10-8-7-9-11-21/h6-13,17,20,25,27,32,35H,1,14-16,18-19H2,2-5H3/t20-,25+,27-,29+/m0/s1 |
| InChIKey | UPFWDHYXNCVYEG-UJGUXOQFSA-N |
| XLogP | 3.44 |
| TPSA | 99.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.72 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|