C23H27FN4O6 — CID 23986383
(2R,4R)-4-(4-fluorophenyl)-2-(4-hydroxybutoxy)-N-[2-[(5-nitro-2-pyridinyl)amino]ethyl]-3,4-dihydro-2H-pyran-6-carboxamide (PubChem CID 23986383) has the molecular formula C23H27FN4O6 and a molecular weight of 474.49 g/mol. Its IUPAC name is (2R,4R)-4-(4-fluorophenyl)-2-(4-hydroxybutoxy)-N-[2-[(5-nitro-2-pyridinyl)amino]ethyl]-3,4-dihydro-2H-pyran-6-carboxamide.
| Compound Name | (2R,4R)-4-(4-fluorophenyl)-2-(4-hydroxybutoxy)-N-[2-[(5-nitro-2-pyridinyl)amino]ethyl]-3,4-dihydro-2H-pyran-6-carboxamide |
|---|---|
| PubChem CID | 23986383 |
| Molecular Formula | C23H27FN4O6 |
| Molecular Weight | 474.49 g/mol |
| Exact Mass | 474.19 |
| IUPAC Name | (2R,4R)-4-(4-fluorophenyl)-2-(4-hydroxybutoxy)-N-[2-[(5-nitro-2-pyridinyl)amino]ethyl]-3,4-dihydro-2H-pyran-6-carboxamide |
| SMILES | O=C(NCCNc1ccc([N+](=O)[O-])cn1)C1=C[C@H](c2ccc(F)cc2)C[C@H](OCCCCO)O1 |
| InChI | InChI=1S/C23H27FN4O6/c24-18-5-3-16(4-6-18)17-13-20(34-22(14-17)33-12-2-1-11-29)23(30)26-10-9-25-21-8-7-19(15-27-21)28(31)32/h3-8,13,15,17,22,29H,1-2,9-12,14H2,(H,25,27)(H,26,30)/t17-,22+/m0/s1 |
| InChIKey | CDSBNDIPDSTAGI-HTAPYJJXSA-N |
| XLogP | 2.86 |
| TPSA | 135.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.49 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|