About N-(4-amino-1,2,5-oxadiazol-3-yl)-2-pyrimidin-2-ylsulfanylacetamide
N-(4-amino-1,2,5-oxadiazol-3-yl)-2-pyrimidin-2-ylsulfanylacetamide (PubChem CID 23986878) has the molecular formula C8H8N6O2S
and a molecular weight of 252.26 g/mol. Its IUPAC name is N-(4-amino-1,2,5-oxadiazol-3-yl)-2-pyrimidin-2-ylsulfanylacetamide.
Molecular Properties
| Compound Name | N-(4-amino-1,2,5-oxadiazol-3-yl)-2-pyrimidin-2-ylsulfanylacetamide |
| PubChem CID | 23986878 |
| Molecular Formula | C8H8N6O2S |
| Molecular Weight | 252.26 g/mol |
| Exact Mass | 252.04 |
| IUPAC Name | N-(4-amino-1,2,5-oxadiazol-3-yl)-2-pyrimidin-2-ylsulfanylacetamide |
| SMILES | Nc1nonc1NC(=O)CSc1ncccn1 |
| InChI | InChI=1S/C8H8N6O2S/c9-6-7(14-16-13-6)12-5(15)4-17-8-10-2-1-3-11-8/h1-3H,4H2,(H2,9,13)(H,12,14,15) |
| InChIKey | YSCGDIZZSRVJIP-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 119.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.26 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze N-(4-amino-1,2,5-oxadiazol-3-yl)-2-pyrimidin-2-ylsulfanylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-amino-1,2,5-oxadiazol-3-yl)-2-pyrimidin-2-ylsulfanylacetamide?
The IUPAC name of N-(4-amino-1,2,5-oxadiazol-3-yl)-2-pyrimidin-2-ylsulfanylacetamide (CID 23986878) is N-(4-amino-1,2,5-oxadiazol-3-yl)-2-pyrimidin-2-ylsulfanylacetamide.
What is the SMILES notation for N-(4-amino-1,2,5-oxadiazol-3-yl)-2-pyrimidin-2-ylsulfanylacetamide?
The canonical SMILES for N-(4-amino-1,2,5-oxadiazol-3-yl)-2-pyrimidin-2-ylsulfanylacetamide is Nc1nonc1NC(=O)CSc1ncccn1.
What is the InChIKey of N-(4-amino-1,2,5-oxadiazol-3-yl)-2-pyrimidin-2-ylsulfanylacetamide?
The InChIKey is YSCGDIZZSRVJIP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N6O2S/c9-6-7(14-16-13-6)12-5(15)4-17-8-10-2-1-3-11-8/h1-3H,4H2,(H2,9,13)(H,12,14,15).
What are the key properties of N-(4-amino-1,2,5-oxadiazol-3-yl)-2-pyrimidin-2-ylsulfanylacetamide?
N-(4-amino-1,2,5-oxadiazol-3-yl)-2-pyrimidin-2-ylsulfanylacetamide has a molecular weight of 252.26 g/mol, XLogP of 0.17, 4 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-amino-1,2,5-oxadiazol-3-yl)-2-pyrimidin-2-ylsulfanylacetamide is sourced from PubChem (CID 23986878), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).