About N-tert-butyl-3,5,7-trimethyladamantane-1-carboxamide
N-tert-butyl-3,5,7-trimethyladamantane-1-carboxamide (PubChem CID 23987010) has the molecular formula C18H31NO
and a molecular weight of 277.45 g/mol. Its IUPAC name is N-tert-butyl-3,5,7-trimethyladamantane-1-carboxamide.
Molecular Properties
| Compound Name | N-tert-butyl-3,5,7-trimethyladamantane-1-carboxamide |
| PubChem CID | 23987010 |
| Molecular Formula | C18H31NO |
| Molecular Weight | 277.45 g/mol |
| Exact Mass | 277.24 |
| IUPAC Name | N-tert-butyl-3,5,7-trimethyladamantane-1-carboxamide |
| SMILES | CC12CC3(C)CC(C)(C1)CC(C(=O)NC(C)(C)C)(C2)C3 |
| InChI | InChI=1S/C18H31NO/c1-14(2,3)19-13(20)18-10-15(4)7-16(5,11-18)9-17(6,8-15)12-18/h7-12H2,1-6H3,(H,19,20) |
| InChIKey | VEZINZUXQKXUPV-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.45 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-tert-butyl-3,5,7-trimethyladamantane-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-tert-butyl-3,5,7-trimethyladamantane-1-carboxamide?
The IUPAC name of N-tert-butyl-3,5,7-trimethyladamantane-1-carboxamide (CID 23987010) is N-tert-butyl-3,5,7-trimethyladamantane-1-carboxamide.
What is the SMILES notation for N-tert-butyl-3,5,7-trimethyladamantane-1-carboxamide?
The canonical SMILES for N-tert-butyl-3,5,7-trimethyladamantane-1-carboxamide is CC12CC3(C)CC(C)(C1)CC(C(=O)NC(C)(C)C)(C2)C3.
What is the InChIKey of N-tert-butyl-3,5,7-trimethyladamantane-1-carboxamide?
The InChIKey is VEZINZUXQKXUPV-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H31NO/c1-14(2,3)19-13(20)18-10-15(4)7-16(5,11-18)9-17(6,8-15)12-18/h7-12H2,1-6H3,(H,19,20).
What are the key properties of N-tert-butyl-3,5,7-trimethyladamantane-1-carboxamide?
N-tert-butyl-3,5,7-trimethyladamantane-1-carboxamide has a molecular weight of 277.45 g/mol, XLogP of 4.29, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-tert-butyl-3,5,7-trimethyladamantane-1-carboxamide is sourced from PubChem (CID 23987010), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).