About (3-fluorophenyl) naphthalene-1-carboxylate
(3-fluorophenyl) naphthalene-1-carboxylate (PubChem CID 2398711) has the molecular formula C17H11FO2
and a molecular weight of 266.27 g/mol. Its IUPAC name is (3-fluorophenyl) naphthalene-1-carboxylate.
Molecular Properties
| Compound Name | (3-fluorophenyl) naphthalene-1-carboxylate |
| PubChem CID | 2398711 |
| Molecular Formula | C17H11FO2 |
| Molecular Weight | 266.27 g/mol |
| Exact Mass | 266.07 |
| IUPAC Name | (3-fluorophenyl) naphthalene-1-carboxylate |
| SMILES | O=C(Oc1cccc(F)c1)c1cccc2ccccc12 |
| InChI | InChI=1S/C17H11FO2/c18-13-7-4-8-14(11-13)20-17(19)16-10-3-6-12-5-1-2-9-15(12)16/h1-11H |
| InChIKey | YSIGCLZDQDNLPC-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.27 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (3-fluorophenyl) naphthalene-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-fluorophenyl) naphthalene-1-carboxylate?
The IUPAC name of (3-fluorophenyl) naphthalene-1-carboxylate (CID 2398711) is (3-fluorophenyl) naphthalene-1-carboxylate.
What is the SMILES notation for (3-fluorophenyl) naphthalene-1-carboxylate?
The canonical SMILES for (3-fluorophenyl) naphthalene-1-carboxylate is O=C(Oc1cccc(F)c1)c1cccc2ccccc12.
What is the InChIKey of (3-fluorophenyl) naphthalene-1-carboxylate?
The InChIKey is YSIGCLZDQDNLPC-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H11FO2/c18-13-7-4-8-14(11-13)20-17(19)16-10-3-6-12-5-1-2-9-15(12)16/h1-11H.
What are the key properties of (3-fluorophenyl) naphthalene-1-carboxylate?
(3-fluorophenyl) naphthalene-1-carboxylate has a molecular weight of 266.27 g/mol, XLogP of 4.20, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3-fluorophenyl) naphthalene-1-carboxylate is sourced from PubChem (CID 2398711), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).