About (3,5-dichlorophenyl)-(5-fluoro-1'-methylspiro[2H-indole-3,4'-piperidine]-1-yl)methanone
(3,5-dichlorophenyl)-(5-fluoro-1'-methylspiro[2H-indole-3,4'-piperidine]-1-yl)methanone (PubChem CID 23989391) has the molecular formula C20H19Cl2FN2O
and a molecular weight of 393.29 g/mol. Its IUPAC name is (3,5-dichlorophenyl)-(5-fluoro-1'-methylspiro[2H-indole-3,4'-piperidine]-1-yl)methanone.
Molecular Properties
| Compound Name | (3,5-dichlorophenyl)-(5-fluoro-1'-methylspiro[2H-indole-3,4'-piperidine]-1-yl)methanone |
| PubChem CID | 23989391 |
| Molecular Formula | C20H19Cl2FN2O |
| Molecular Weight | 393.29 g/mol |
| Exact Mass | 392.09 |
| IUPAC Name | (3,5-dichlorophenyl)-(5-fluoro-1'-methylspiro[2H-indole-3,4'-piperidine]-1-yl)methanone |
| SMILES | CN1CCC2(CC1)CN(C(=O)c1cc(Cl)cc(Cl)c1)c1ccc(F)cc12 |
| InChI | InChI=1S/C20H19Cl2FN2O/c1-24-6-4-20(5-7-24)12-25(18-3-2-16(23)11-17(18)20)19(26)13-8-14(21)10-15(22)9-13/h2-3,8-11H,4-7,12H2,1H3 |
| InChIKey | BXIZFAVIAKRZCS-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 393.29 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (3,5-dichlorophenyl)-(5-fluoro-1'-methylspiro[2H-indole-3,4'-piperidine]-1-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3,5-dichlorophenyl)-(5-fluoro-1'-methylspiro[2H-indole-3,4'-piperidine]-1-yl)methanone?
The IUPAC name of (3,5-dichlorophenyl)-(5-fluoro-1'-methylspiro[2H-indole-3,4'-piperidine]-1-yl)methanone (CID 23989391) is (3,5-dichlorophenyl)-(5-fluoro-1'-methylspiro[2H-indole-3,4'-piperidine]-1-yl)methanone.
What is the SMILES notation for (3,5-dichlorophenyl)-(5-fluoro-1'-methylspiro[2H-indole-3,4'-piperidine]-1-yl)methanone?
The canonical SMILES for (3,5-dichlorophenyl)-(5-fluoro-1'-methylspiro[2H-indole-3,4'-piperidine]-1-yl)methanone is CN1CCC2(CC1)CN(C(=O)c1cc(Cl)cc(Cl)c1)c1ccc(F)cc12.
What is the InChIKey of (3,5-dichlorophenyl)-(5-fluoro-1'-methylspiro[2H-indole-3,4'-piperidine]-1-yl)methanone?
The InChIKey is BXIZFAVIAKRZCS-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H19Cl2FN2O/c1-24-6-4-20(5-7-24)12-25(18-3-2-16(23)11-17(18)20)19(26)13-8-14(21)10-15(22)9-13/h2-3,8-11H,4-7,12H2,1H3.
What are the key properties of (3,5-dichlorophenyl)-(5-fluoro-1'-methylspiro[2H-indole-3,4'-piperidine]-1-yl)methanone?
(3,5-dichlorophenyl)-(5-fluoro-1'-methylspiro[2H-indole-3,4'-piperidine]-1-yl)methanone has a molecular weight of 393.29 g/mol, XLogP of 4.76, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3,5-dichlorophenyl)-(5-fluoro-1'-methylspiro[2H-indole-3,4'-piperidine]-1-yl)methanone is sourced from PubChem (CID 23989391), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).