C24H20N6O5S2 — CID 23990134
ethyl 2-[[3-nitro-4-(1-phenyltetrazol-5-yl)sulfanylbenzoyl]amino]-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxylate (PubChem CID 23990134) has the molecular formula C24H20N6O5S2 and a molecular weight of 536.60 g/mol. Its IUPAC name is ethyl 2-[[3-nitro-4-(1-phenyltetrazol-5-yl)sulfanylbenzoyl]amino]-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxylate.
| Compound Name | ethyl 2-[[3-nitro-4-(1-phenyltetrazol-5-yl)sulfanylbenzoyl]amino]-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 23990134 |
| Molecular Formula | C24H20N6O5S2 |
| Molecular Weight | 536.60 g/mol |
| Exact Mass | 536.09 |
| IUPAC Name | ethyl 2-[[3-nitro-4-(1-phenyltetrazol-5-yl)sulfanylbenzoyl]amino]-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)c2ccc(Sc3nnnn3-c3ccccc3)c([N+](=O)[O-])c2)sc2c1CCC2 |
| InChI | InChI=1S/C24H20N6O5S2/c1-2-35-23(32)20-16-9-6-10-18(16)36-22(20)25-21(31)14-11-12-19(17(13-14)30(33)34)37-24-26-27-28-29(24)15-7-4-3-5-8-15/h3-5,7-8,11-13H,2,6,9-10H2,1H3,(H,25,31) |
| InChIKey | SEZHWRKTZUHTMG-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 142.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.60 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|