About 2,2-dimethyl-N'-[(3-phenoxyphenyl)methyl]-N'-(pyridin-4-ylmethyl)propane-1,3-diamine
2,2-dimethyl-N'-[(3-phenoxyphenyl)methyl]-N'-(pyridin-4-ylmethyl)propane-1,3-diamine (PubChem CID 23990548) has the molecular formula C24H29N3O
and a molecular weight of 375.52 g/mol. Its IUPAC name is 2,2-dimethyl-N'-[(3-phenoxyphenyl)methyl]-N'-(pyridin-4-ylmethyl)propane-1,3-diamine.
Molecular Properties
| Compound Name | 2,2-dimethyl-N'-[(3-phenoxyphenyl)methyl]-N'-(pyridin-4-ylmethyl)propane-1,3-diamine |
| PubChem CID | 23990548 |
| Molecular Formula | C24H29N3O |
| Molecular Weight | 375.52 g/mol |
| Exact Mass | 375.23 |
| IUPAC Name | 2,2-dimethyl-N'-[(3-phenoxyphenyl)methyl]-N'-(pyridin-4-ylmethyl)propane-1,3-diamine |
| SMILES | CC(C)(CN)CN(Cc1ccncc1)Cc1cccc(Oc2ccccc2)c1 |
| InChI | InChI=1S/C24H29N3O/c1-24(2,18-25)19-27(16-20-11-13-26-14-12-20)17-21-7-6-10-23(15-21)28-22-8-4-3-5-9-22/h3-15H,16-19,25H2,1-2H3 |
| InChIKey | IWBZQPAIRBNODM-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 51.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 375.52 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2,2-dimethyl-N'-[(3-phenoxyphenyl)methyl]-N'-(pyridin-4-ylmethyl)propane-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-dimethyl-N'-[(3-phenoxyphenyl)methyl]-N'-(pyridin-4-ylmethyl)propane-1,3-diamine?
The IUPAC name of 2,2-dimethyl-N'-[(3-phenoxyphenyl)methyl]-N'-(pyridin-4-ylmethyl)propane-1,3-diamine (CID 23990548) is 2,2-dimethyl-N'-[(3-phenoxyphenyl)methyl]-N'-(pyridin-4-ylmethyl)propane-1,3-diamine.
What is the SMILES notation for 2,2-dimethyl-N'-[(3-phenoxyphenyl)methyl]-N'-(pyridin-4-ylmethyl)propane-1,3-diamine?
The canonical SMILES for 2,2-dimethyl-N'-[(3-phenoxyphenyl)methyl]-N'-(pyridin-4-ylmethyl)propane-1,3-diamine is CC(C)(CN)CN(Cc1ccncc1)Cc1cccc(Oc2ccccc2)c1.
What is the InChIKey of 2,2-dimethyl-N'-[(3-phenoxyphenyl)methyl]-N'-(pyridin-4-ylmethyl)propane-1,3-diamine?
The InChIKey is IWBZQPAIRBNODM-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H29N3O/c1-24(2,18-25)19-27(16-20-11-13-26-14-12-20)17-21-7-6-10-23(15-21)28-22-8-4-3-5-9-22/h3-15H,16-19,25H2,1-2H3.
What are the key properties of 2,2-dimethyl-N'-[(3-phenoxyphenyl)methyl]-N'-(pyridin-4-ylmethyl)propane-1,3-diamine?
2,2-dimethyl-N'-[(3-phenoxyphenyl)methyl]-N'-(pyridin-4-ylmethyl)propane-1,3-diamine has a molecular weight of 375.52 g/mol, XLogP of 4.86, 9 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dimethyl-N'-[(3-phenoxyphenyl)methyl]-N'-(pyridin-4-ylmethyl)propane-1,3-diamine is sourced from PubChem (CID 23990548), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).