C18H13Cl4NO2 — CID 23991028
2-(4-butylphenyl)-4,5,6,7-tetrachloroisoindole-1,3-dione (PubChem CID 23991028) has the molecular formula C18H13Cl4NO2 and a molecular weight of 417.12 g/mol. Its IUPAC name is 2-(4-butylphenyl)-4,5,6,7-tetrachloroisoindole-1,3-dione.
| Compound Name | 2-(4-butylphenyl)-4,5,6,7-tetrachloroisoindole-1,3-dione |
|---|---|
| PubChem CID | 23991028 |
| Molecular Formula | C18H13Cl4NO2 |
| Molecular Weight | 417.12 g/mol |
| Exact Mass | 414.97 |
| IUPAC Name | 2-(4-butylphenyl)-4,5,6,7-tetrachloroisoindole-1,3-dione |
| SMILES | CCCCc1ccc(N2C(=O)c3c(Cl)c(Cl)c(Cl)c(Cl)c3C2=O)cc1 |
| InChI | InChI=1S/C18H13Cl4NO2/c1-2-3-4-9-5-7-10(8-6-9)23-17(24)11-12(18(23)25)14(20)16(22)15(21)13(11)19/h5-8H,2-4H2,1H3 |
| InChIKey | TZELIQAWUVUWRC-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.12 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|