C24H31N3S — CID 23991781
N-(2,6-diethylphenyl)-2,8-dimethyl-3,4,4a,9b-tetrahydro-1H-pyrido[4,3-b]indole-5-carbothioamide (PubChem CID 23991781) has the molecular formula C24H31N3S and a molecular weight of 393.60 g/mol. Its IUPAC name is N-(2,6-diethylphenyl)-2,8-dimethyl-3,4,4a,9b-tetrahydro-1H-pyrido[4,3-b]indole-5-carbothioamide.
| Compound Name | N-(2,6-diethylphenyl)-2,8-dimethyl-3,4,4a,9b-tetrahydro-1H-pyrido[4,3-b]indole-5-carbothioamide |
|---|---|
| PubChem CID | 23991781 |
| Molecular Formula | C24H31N3S |
| Molecular Weight | 393.60 g/mol |
| Exact Mass | 393.22 |
| IUPAC Name | N-(2,6-diethylphenyl)-2,8-dimethyl-3,4,4a,9b-tetrahydro-1H-pyrido[4,3-b]indole-5-carbothioamide |
| SMILES | CCc1cccc(CC)c1NC(=S)N1c2ccc(C)cc2C2CN(C)CCC21 |
| InChI | InChI=1S/C24H31N3S/c1-5-17-8-7-9-18(6-2)23(17)25-24(28)27-21-11-10-16(3)14-19(21)20-15-26(4)13-12-22(20)27/h7-11,14,20,22H,5-6,12-13,15H2,1-4H3,(H,25,28) |
| InChIKey | VEAFKHBAFOYKTE-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.60 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|