C28H20FN3O3S — CID 23991945
2-[3-(2-fluorophenyl)-4-oxoquinazolin-2-yl]sulfanyl-N-(2-phenoxyphenyl)acetamide (PubChem CID 23991945) has the molecular formula C28H20FN3O3S and a molecular weight of 497.55 g/mol. Its IUPAC name is 2-[3-(2-fluorophenyl)-4-oxoquinazolin-2-yl]sulfanyl-N-(2-phenoxyphenyl)acetamide.
| Compound Name | 2-[3-(2-fluorophenyl)-4-oxoquinazolin-2-yl]sulfanyl-N-(2-phenoxyphenyl)acetamide |
|---|---|
| PubChem CID | 23991945 |
| Molecular Formula | C28H20FN3O3S |
| Molecular Weight | 497.55 g/mol |
| Exact Mass | 497.12 |
| IUPAC Name | 2-[3-(2-fluorophenyl)-4-oxoquinazolin-2-yl]sulfanyl-N-(2-phenoxyphenyl)acetamide |
| SMILES | O=C(CSc1nc2ccccc2c(=O)n1-c1ccccc1F)Nc1ccccc1Oc1ccccc1 |
| InChI | InChI=1S/C28H20FN3O3S/c29-21-13-5-8-16-24(21)32-27(34)20-12-4-6-14-22(20)31-28(32)36-18-26(33)30-23-15-7-9-17-25(23)35-19-10-2-1-3-11-19/h1-17H,18H2,(H,30,33) |
| InChIKey | KHLMLPWREXLIKB-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.55 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |