C18H20O6 — CID 23992581
2,6,11,15-tetraoxatricyclo[14.2.2.27,10]docosa-1(19),7,9,16(20),17,21-hexaene-4,13-diol (PubChem CID 23992581) has the molecular formula C18H20O6 and a molecular weight of 332.35 g/mol. Its IUPAC name is 2,6,11,15-tetraoxatricyclo[14.2.2.27,10]docosa-1(19),7,9,16(20),17,21-hexaene-4,13-diol.
| Compound Name | 2,6,11,15-tetraoxatricyclo[14.2.2.27,10]docosa-1(19),7,9,16(20),17,21-hexaene-4,13-diol |
|---|---|
| PubChem CID | 23992581 |
| Molecular Formula | C18H20O6 |
| Molecular Weight | 332.35 g/mol |
| Exact Mass | 332.13 |
| IUPAC Name | 2,6,11,15-tetraoxatricyclo[14.2.2.27,10]docosa-1(19),7,9,16(20),17,21-hexaene-4,13-diol |
| SMILES | OC1COc2ccc(cc2)OCC(O)COc2ccc(cc2)OC1 |
| InChI | InChI=1S/C18H20O6/c19-13-9-21-15-1-2-16(4-3-15)22-10-14(20)12-24-18-7-5-17(6-8-18)23-11-13/h1-8,13-14,19-20H,9-12H2 |
| InChIKey | RAZQALDNXTXZOL-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.35 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |