C12H10N4O2 — CID 23995174
1,7-dimethoxypyrrolo[3,4-f]isoindole-3,5-diimine (PubChem CID 23995174) has the molecular formula C12H10N4O2 and a molecular weight of 242.24 g/mol. Its IUPAC name is 1,7-dimethoxypyrrolo[3,4-f]isoindole-3,5-diimine.
| Compound Name | 1,7-dimethoxypyrrolo[3,4-f]isoindole-3,5-diimine |
|---|---|
| PubChem CID | 23995174 |
| Molecular Formula | C12H10N4O2 |
| Molecular Weight | 242.24 g/mol |
| Exact Mass | 242.08 |
| IUPAC Name | 1,7-dimethoxypyrrolo[3,4-f]isoindole-3,5-diimine |
| SMILES | [H]/N=c1\nc(OC)c2cc3c(OC)n/c(=N\[H])c3cc12 |
| InChI | InChI=1S/C12H10N4O2/c1-17-11-7-4-8-6(3-5(7)9(13)15-11)10(14)16-12(8)18-2/h3-4,13-14H,1-2H3/b13-9-,14-10- |
| InChIKey | BNDCOMZZHSMFGK-FOIMCPNXSA-N |
| XLogP | 0.63 |
| TPSA | 91.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.24 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |