C33H35N5OS — CID 23995758
4-[[4-(4-cyclohexylphenyl)-3-(2-pyridin-2-ylethyl)-1,3-thiazol-2-ylidene]amino]-1,5-dimethyl-2-phenylpyrazol-3-one (PubChem CID 23995758) has the molecular formula C33H35N5OS and a molecular weight of 549.74 g/mol. Its IUPAC name is 4-[[4-(4-cyclohexylphenyl)-3-(2-pyridin-2-ylethyl)-1,3-thiazol-2-ylidene]amino]-1,5-dimethyl-2-phenylpyrazol-3-one.
| Compound Name | 4-[[4-(4-cyclohexylphenyl)-3-(2-pyridin-2-ylethyl)-1,3-thiazol-2-ylidene]amino]-1,5-dimethyl-2-phenylpyrazol-3-one |
|---|---|
| PubChem CID | 23995758 |
| Molecular Formula | C33H35N5OS |
| Molecular Weight | 549.74 g/mol |
| Exact Mass | 549.26 |
| IUPAC Name | 4-[[4-(4-cyclohexylphenyl)-3-(2-pyridin-2-ylethyl)-1,3-thiazol-2-ylidene]amino]-1,5-dimethyl-2-phenylpyrazol-3-one |
| SMILES | Cc1c(/N=c2\scc(-c3ccc(C4CCCCC4)cc3)n2CCc2ccccn2)c(=O)n(-c2ccccc2)n1C |
| InChI | InChI=1S/C33H35N5OS/c1-24-31(32(39)38(36(24)2)29-14-7-4-8-15-29)35-33-37(22-20-28-13-9-10-21-34-28)30(23-40-33)27-18-16-26(17-19-27)25-11-5-3-6-12-25/h4,7-10,13-19,21,23,25H,3,5-6,11-12,20,22H2,1-2H3/b35-33- |
| InChIKey | MOZROAHOVYDTPL-OAPYJULQSA-N |
| XLogP | 6.93 |
| TPSA | 57.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.74 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'} |
|---|