C24H23F2N3O2S — CID 23996340
3-(cyclohex-3-en-1-ylmethylideneamino)-N-(2,4-difluorophenyl)-4-(2,5-dimethoxyphenyl)-1,3-thiazol-2-imine (PubChem CID 23996340) has the molecular formula C24H23F2N3O2S and a molecular weight of 455.53 g/mol. Its IUPAC name is 3-(cyclohex-3-en-1-ylmethylideneamino)-N-(2,4-difluorophenyl)-4-(2,5-dimethoxyphenyl)-1,3-thiazol-2-imine.
| Compound Name | 3-(cyclohex-3-en-1-ylmethylideneamino)-N-(2,4-difluorophenyl)-4-(2,5-dimethoxyphenyl)-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 23996340 |
| Molecular Formula | C24H23F2N3O2S |
| Molecular Weight | 455.53 g/mol |
| Exact Mass | 455.15 |
| IUPAC Name | 3-(cyclohex-3-en-1-ylmethylideneamino)-N-(2,4-difluorophenyl)-4-(2,5-dimethoxyphenyl)-1,3-thiazol-2-imine |
| SMILES | COc1ccc(OC)c(-c2cs/c(=N\c3ccc(F)cc3F)n2N=CC2CC=CCC2)c1 |
| InChI | InChI=1S/C24H23F2N3O2S/c1-30-18-9-11-23(31-2)19(13-18)22-15-32-24(28-21-10-8-17(25)12-20(21)26)29(22)27-14-16-6-4-3-5-7-16/h3-4,8-16H,5-7H2,1-2H3/b27-14?,28-24- |
| InChIKey | HKDJBNXVBHNHLZ-OQNHBGQBSA-N |
| XLogP | 5.93 |
| TPSA | 48.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.53 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|